C11H18S3 — CID 87707145
2,5-bis(thiiran-2-ylmethyl)thiane (PubChem CID 87707145) has the molecular formula C11H18S3 and a molecular weight of 246.47 g/mol. Its IUPAC name is 2,5-bis(thiiran-2-ylmethyl)thiane.
| Compound Name | 2,5-bis(thiiran-2-ylmethyl)thiane |
|---|---|
| PubChem CID | 87707145 |
| Molecular Formula | C11H18S3 |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2,5-bis(thiiran-2-ylmethyl)thiane |
| SMILES | C1CC(CC2CS2)SCC1CC1CS1 |
| InChI | InChI=1S/C11H18S3/c1-2-9(4-11-7-14-11)12-5-8(1)3-10-6-13-10/h8-11H,1-7H2 |
| InChIKey | YNPDRACBXJYBBO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|