C4H8SSe2 — CID 174438951
2-(thiiran-2-yl)ethane-1,1-diselenol (PubChem CID 174438951) has the molecular formula C4H8SSe2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 2-(thiiran-2-yl)ethane-1,1-diselenol.
| Compound Name | 2-(thiiran-2-yl)ethane-1,1-diselenol |
|---|---|
| PubChem CID | 174438951 |
| Molecular Formula | C4H8SSe2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 247.87 |
| IUPAC Name | 2-(thiiran-2-yl)ethane-1,1-diselenol |
| SMILES | [SeH]C([SeH])CC1CS1 |
| InChI | InChI=1S/C4H8SSe2/c6-4(7)1-3-2-5-3/h3-4,6-7H,1-2H2 |
| InChIKey | JDGUBROIWPBTKY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|