C12H20S2Se4 — CID 173200709
1-[2-[1-selanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenan-5-yl]-2-(thiiran-2-yl)ethaneselenol (PubChem CID 173200709) has the molecular formula C12H20S2Se4 and a molecular weight of 544.27 g/mol. Its IUPAC name is 1-[2-[1-selanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenan-5-yl]-2-(thiiran-2-yl)ethaneselenol.
| Compound Name | 1-[2-[1-selanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenan-5-yl]-2-(thiiran-2-yl)ethaneselenol |
|---|---|
| PubChem CID | 173200709 |
| Molecular Formula | C12H20S2Se4 |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 547.77 |
| IUPAC Name | 1-[2-[1-selanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenan-5-yl]-2-(thiiran-2-yl)ethaneselenol |
| SMILES | [SeH]C(CC1CS1)C1C[Se]C(C([SeH])CC2CS2)[Se]C1 |
| InChI | InChI=1S/C12H20S2Se4/c15-10(1-8-3-13-8)7-5-17-12(18-6-7)11(16)2-9-4-14-9/h7-12,15-16H,1-6H2 |
| InChIKey | KTQWFSRNPHBDHG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|