C11H18S2Se2Te2 — CID 173200720
1-[2-[1-tellanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenolan-4-yl]-2-(thiiran-2-yl)ethanetellurol (PubChem CID 173200720) has the molecular formula C11H18S2Se2Te2 and a molecular weight of 627.52 g/mol. Its IUPAC name is 1-[2-[1-tellanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenolan-4-yl]-2-(thiiran-2-yl)ethanetellurol.
| Compound Name | 1-[2-[1-tellanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenolan-4-yl]-2-(thiiran-2-yl)ethanetellurol |
|---|---|
| PubChem CID | 173200720 |
| Molecular Formula | C11H18S2Se2Te2 |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 633.73 |
| IUPAC Name | 1-[2-[1-tellanyl-2-(thiiran-2-yl)ethyl]-1,3-diselenolan-4-yl]-2-(thiiran-2-yl)ethanetellurol |
| SMILES | [TeH]C(CC1CS1)C1C[Se]C(C([TeH])CC2CS2)[Se]1 |
| InChI | InChI=1S/C11H18S2Se2Te2/c16-9(1-6-3-12-6)8-5-14-11(15-8)10(17)2-7-4-13-7/h6-11,16-17H,1-5H2 |
| InChIKey | AAWBVIZJCQXVRQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|