C9H23N3O5 — CID 87708829
[bis(hydroxymethyl)amino]methanol;2,6-diaminohexanoic acid (PubChem CID 87708829) has the molecular formula C9H23N3O5 and a molecular weight of 253.30 g/mol. Its IUPAC name is [bis(hydroxymethyl)amino]methanol;2,6-diaminohexanoic acid.
| Compound Name | [bis(hydroxymethyl)amino]methanol;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87708829 |
| Molecular Formula | C9H23N3O5 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | [bis(hydroxymethyl)amino]methanol;2,6-diaminohexanoic acid |
| SMILES | NCCCCC(N)C(=O)O.OCN(CO)CO |
| InChI | InChI=1S/C6H14N2O2.C3H9NO3/c7-4-2-1-3-5(8)6(9)10;5-1-4(2-6)3-7/h5H,1-4,7-8H2,(H,9,10);5-7H,1-3H2 |
| InChIKey | XUPYVFBZBQNQMV-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|