C22H24ClFIN3O5S — CID 87710268
N-[5-[butanoyl-(iodoamino)amino]-2-methoxyphenyl]-3-fluoro-4-(5-methylfuran-2-yl)benzenesulfonamide;hydrochloride (PubChem CID 87710268) has the molecular formula C22H24ClFIN3O5S and a molecular weight of 623.87 g/mol. Its IUPAC name is N-[5-[butanoyl-(iodoamino)amino]-2-methoxyphenyl]-3-fluoro-4-(5-methylfuran-2-yl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[5-[butanoyl-(iodoamino)amino]-2-methoxyphenyl]-3-fluoro-4-(5-methylfuran-2-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 87710268 |
| Molecular Formula | C22H24ClFIN3O5S |
| Molecular Weight | 623.87 g/mol |
| Exact Mass | 623.02 |
| IUPAC Name | N-[5-[butanoyl-(iodoamino)amino]-2-methoxyphenyl]-3-fluoro-4-(5-methylfuran-2-yl)benzenesulfonamide;hydrochloride |
| SMILES | CCCC(=O)N(NI)c1ccc(OC)c(NS(=O)(=O)c2ccc(-c3ccc(C)o3)c(F)c2)c1.Cl |
| InChI | InChI=1S/C22H23FIN3O5S.ClH/c1-4-5-22(28)27(26-24)15-7-11-21(31-3)19(12-15)25-33(29,30)16-8-9-17(18(23)13-16)20-10-6-14(2)32-20;/h6-13,25-26H,4-5H2,1-3H3;1H |
| InChIKey | GHOPWQWRIPUHOS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|