C16H20N4O4S — CID 87714087
[5-[4-(pentan-3-ylcarbamoylamino)phenoxy]-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87714087) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is [5-[4-(pentan-3-ylcarbamoylamino)phenoxy]-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [5-[4-(pentan-3-ylcarbamoylamino)phenoxy]-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87714087 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [5-[4-(pentan-3-ylcarbamoylamino)phenoxy]-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CCC(CC)NC(=O)Nc1ccc(Oc2cnc(NC(=O)O)s2)cc1 |
| InChI | InChI=1S/C16H20N4O4S/c1-3-10(4-2)18-14(21)19-11-5-7-12(8-6-11)24-13-9-17-15(25-13)20-16(22)23/h5-10H,3-4H2,1-2H3,(H,17,20)(H,22,23)(H2,18,19,21) |
| InChIKey | OSIFNZYAVURIJB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |