C30H39N3O4 — CID 87717313
tert-butyl 4-[4-[3-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]phenyl]phenoxy]piperidine-1-carboxylate (PubChem CID 87717313) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]phenyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]phenyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87717313 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | tert-butyl 4-[4-[3-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]phenyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)CC(C(=O)N(C)C#N)c1cccc(-c2ccc(OC3CCN(C(=O)OC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C30H39N3O4/c1-21(2)18-27(28(34)32(6)20-31)24-9-7-8-23(19-24)22-10-12-25(13-11-22)36-26-14-16-33(17-15-26)29(35)37-30(3,4)5/h7-13,19,21,26-27H,14-18H2,1-6H3 |
| InChIKey | JUYALXOBUNUTDP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|