C12H20O6 — CID 87719419
(E)-2-(1-tert-butylperoxy-2-methylpropan-2-yl)but-2-enedioic acid (PubChem CID 87719419) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (E)-2-(1-tert-butylperoxy-2-methylpropan-2-yl)but-2-enedioic acid.
| Compound Name | (E)-2-(1-tert-butylperoxy-2-methylpropan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 87719419 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (E)-2-(1-tert-butylperoxy-2-methylpropan-2-yl)but-2-enedioic acid |
| SMILES | CC(C)(C)OOCC(C)(C)/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20O6/c1-11(2,3)18-17-7-12(4,5)8(10(15)16)6-9(13)14/h6H,7H2,1-5H3,(H,13,14)(H,15,16)/b8-6- |
| InChIKey | DHMDRYFYIOUVCF-VURMDHGXSA-N |
| XLogP | 1.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|