C13H24O4 — CID 101372093
ethyl 4-tert-butylperoxy-3,3-dimethyl-2-methylidenebutanoate (PubChem CID 101372093) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 4-tert-butylperoxy-3,3-dimethyl-2-methylidenebutanoate.
| Compound Name | ethyl 4-tert-butylperoxy-3,3-dimethyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 101372093 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | ethyl 4-tert-butylperoxy-3,3-dimethyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC)C(C)(C)COOC(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-8-15-11(14)10(2)13(6,7)9-16-17-12(3,4)5/h2,8-9H2,1,3-7H3 |
| InChIKey | CVMWUQQYPLIORL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|