About O-phenyl 2-fluoropropanethioate
O-phenyl 2-fluoropropanethioate (PubChem CID 87720516) has the molecular formula C9H9FOS
and a molecular weight of 184.24 g/mol. Its IUPAC name is O-phenyl 2-fluoropropanethioate.
Molecular Properties
| Compound Name | O-phenyl 2-fluoropropanethioate |
| PubChem CID | 87720516 |
| Molecular Formula | C9H9FOS |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | O-phenyl 2-fluoropropanethioate |
| SMILES | CC(F)C(=S)Oc1ccccc1 |
| InChI | InChI=1S/C9H9FOS/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | PEGSKGZAPQKBES-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl 2-fluoropropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl 2-fluoropropanethioate?
The IUPAC name of O-phenyl 2-fluoropropanethioate (CID 87720516) is O-phenyl 2-fluoropropanethioate.
What is the SMILES notation for O-phenyl 2-fluoropropanethioate?
The canonical SMILES for O-phenyl 2-fluoropropanethioate is CC(F)C(=S)Oc1ccccc1.
What is the InChIKey of O-phenyl 2-fluoropropanethioate?
The InChIKey is PEGSKGZAPQKBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FOS/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of O-phenyl 2-fluoropropanethioate?
O-phenyl 2-fluoropropanethioate has a molecular weight of 184.24 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl 2-fluoropropanethioate is sourced from PubChem (CID 87720516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).