C22H28ClN3O — CID 87720740
N-(4-tert-butylcyclohexyl)-N-[(6-chloro-3-pyridinyl)methyl]pyridine-3-carboxamide (PubChem CID 87720740) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-N-[(6-chloro-3-pyridinyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-N-[(6-chloro-3-pyridinyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87720740 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-N-[(6-chloro-3-pyridinyl)methyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(Cl)nc2)C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C22H28ClN3O/c1-22(2,3)18-7-9-19(10-8-18)26(15-16-6-11-20(23)25-13-16)21(27)17-5-4-12-24-14-17/h4-6,11-14,18-19H,7-10,15H2,1-3H3 |
| InChIKey | MEJOPBSELLOMKC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|