C20H13AsFN5O2S — CID 87724676
CID 87724676 (PubChem CID 87724676) has the molecular formula C20H13AsFN5O2S and a molecular weight of 481.34 g/mol.
| Compound Name | CID 87724676 |
|---|---|
| PubChem CID | 87724676 |
| Molecular Formula | C20H13AsFN5O2S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(NC(=O)c2csc3ncnc([As])c23)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C20H13AsFN5O2S/c21-17-16-13(9-30-19(16)24-10-23-17)18(28)25-11-5-7-12(8-6-11)26-20(29)27-15-4-2-1-3-14(15)22/h1-10H,(H,25,28)(H2,26,27,29) |
| InChIKey | MQEFCAWGFFEGMB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|