C11H21NO3 — CID 87725612
[(3S)-3-formyl-2,2,5-trimethylhexan-3-yl]carbamic acid (PubChem CID 87725612) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is [(3S)-3-formyl-2,2,5-trimethylhexan-3-yl]carbamic acid.
| Compound Name | [(3S)-3-formyl-2,2,5-trimethylhexan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87725612 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | [(3S)-3-formyl-2,2,5-trimethylhexan-3-yl]carbamic acid |
| SMILES | CC(C)C[C@](C=O)(NC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)6-11(7-13,10(3,4)5)12-9(14)15/h7-8,12H,6H2,1-5H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | CTALSGGWVXKXJH-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|