C23H42O3 — CID 169225610
2,4-bis(3-methylbutan-2-yl)-2,4-bis(2-methylpropyl)-3-oxopentanedial (PubChem CID 169225610) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is 2,4-bis(3-methylbutan-2-yl)-2,4-bis(2-methylpropyl)-3-oxopentanedial.
| Compound Name | 2,4-bis(3-methylbutan-2-yl)-2,4-bis(2-methylpropyl)-3-oxopentanedial |
|---|---|
| PubChem CID | 169225610 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 2,4-bis(3-methylbutan-2-yl)-2,4-bis(2-methylpropyl)-3-oxopentanedial |
| SMILES | CC(C)CC(C=O)(C(=O)C(C=O)(CC(C)C)C(C)C(C)C)C(C)C(C)C |
| InChI | InChI=1S/C23H42O3/c1-15(2)11-22(13-24,19(9)17(5)6)21(26)23(14-25,12-16(3)4)20(10)18(7)8/h13-20H,11-12H2,1-10H3 |
| InChIKey | CGPWKDNCLFGBDS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|