C28H50O4 — CID 173278193
2-ethyl-4,4,5,8,9,9-hexamethyl-6-(2-methylbutanoyl)-3,7-dioxo-2-pentan-3-yldecanal (PubChem CID 173278193) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is 2-ethyl-4,4,5,8,9,9-hexamethyl-6-(2-methylbutanoyl)-3,7-dioxo-2-pentan-3-yldecanal.
| Compound Name | 2-ethyl-4,4,5,8,9,9-hexamethyl-6-(2-methylbutanoyl)-3,7-dioxo-2-pentan-3-yldecanal |
|---|---|
| PubChem CID | 173278193 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 2-ethyl-4,4,5,8,9,9-hexamethyl-6-(2-methylbutanoyl)-3,7-dioxo-2-pentan-3-yldecanal |
| SMILES | CCC(C)C(=O)C(C(=O)C(C)C(C)(C)C)C(C)C(C)(C)C(=O)C(C=O)(CC)C(CC)CC |
| InChI | InChI=1S/C28H50O4/c1-13-18(5)23(30)22(24(31)20(7)26(8,9)10)19(6)27(11,12)25(32)28(16-4,17-29)21(14-2)15-3/h17-22H,13-16H2,1-12H3 |
| InChIKey | MYQGMLZQIQFWEE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|