C20H32O2 — CID 87726391
1,1-bis[(2E,4E)-hepta-2,4-dienoxy]cyclohexane (PubChem CID 87726391) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1,1-bis[(2E,4E)-hepta-2,4-dienoxy]cyclohexane.
| Compound Name | 1,1-bis[(2E,4E)-hepta-2,4-dienoxy]cyclohexane |
|---|---|
| PubChem CID | 87726391 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1,1-bis[(2E,4E)-hepta-2,4-dienoxy]cyclohexane |
| SMILES | CC/C=C/C=C/COC1(OC/C=C/C=C/CC)CCCCC1 |
| InChI | InChI=1S/C20H32O2/c1-3-5-7-9-14-18-21-20(16-12-11-13-17-20)22-19-15-10-8-6-4-2/h5-10,14-15H,3-4,11-13,16-19H2,1-2H3/b7-5+,8-6+,14-9+,15-10+ |
| InChIKey | ZWELFMFSSFOUSJ-FNFHSPGHSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|