C23H23ClN2O4S — CID 87726756
N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(2-hydroxy-2-phenylethyl)formamide (PubChem CID 87726756) has the molecular formula C23H23ClN2O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(2-hydroxy-2-phenylethyl)formamide.
| Compound Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(2-hydroxy-2-phenylethyl)formamide |
|---|---|
| PubChem CID | 87726756 |
| Molecular Formula | C23H23ClN2O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(2-hydroxy-2-phenylethyl)formamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1Cl)c1ccc(N(C=O)CC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O4S/c1-31(29,30)26(15-19-9-5-6-10-22(19)24)21-13-11-20(12-14-21)25(17-27)16-23(28)18-7-3-2-4-8-18/h2-14,17,23,28H,15-16H2,1H3 |
| InChIKey | CJNXQDSCEUYSPO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|