C25H23ClN4O3S — CID 87726763
N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(1-methyl-3-phenylpyrazol-5-yl)formamide (PubChem CID 87726763) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(1-methyl-3-phenylpyrazol-5-yl)formamide.
| Compound Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(1-methyl-3-phenylpyrazol-5-yl)formamide |
|---|---|
| PubChem CID | 87726763 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(1-methyl-3-phenylpyrazol-5-yl)formamide |
| SMILES | Cn1nc(-c2ccccc2)cc1N(C=O)c1ccc(N(Cc2ccccc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H23ClN4O3S/c1-28-25(16-24(27-28)19-8-4-3-5-9-19)29(18-31)21-12-14-22(15-13-21)30(34(2,32)33)17-20-10-6-7-11-23(20)26/h3-16,18H,17H2,1-2H3 |
| InChIKey | FWBUIFPJWQARPB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|