C18H17ClN4O3S2 — CID 87729330
N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)formamide (PubChem CID 87729330) has the molecular formula C18H17ClN4O3S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)formamide.
| Compound Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)formamide |
|---|---|
| PubChem CID | 87729330 |
| Molecular Formula | C18H17ClN4O3S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | N-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)formamide |
| SMILES | Cc1nnc(N(C=O)c2ccc(N(Cc3ccccc3Cl)S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C18H17ClN4O3S2/c1-13-20-21-18(27-13)22(12-24)15-7-9-16(10-8-15)23(28(2,25)26)11-14-5-3-4-6-17(14)19/h3-10,12H,11H2,1-2H3 |
| InChIKey | DUQFPCQLYKMKKR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|