C24H26AsNO3 — CID 87728429
CID 87728429 (PubChem CID 87728429) has the molecular formula C24H26AsNO3 and a molecular weight of 451.40 g/mol.
| Compound Name | CID 87728429 |
|---|---|
| PubChem CID | 87728429 |
| Molecular Formula | C24H26AsNO3 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(C(C)([As])C(=O)O)c(-c2ccc(C(=O)CCN)c(CC=C)c2)c1 |
| InChI | InChI=1S/C24H26AsNO3/c1-4-6-16-8-11-21(24(3,25)23(28)29)20(14-16)18-9-10-19(22(27)12-13-26)17(15-18)7-5-2/h4-5,8-11,14-15H,1-2,6-7,12-13,26H2,3H3,(H,28,29) |
| InChIKey | UWFPEWVKWFGIRT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|