About CID 87728429
CID 87728429 (PubChem CID 87728429) has the molecular formula C24H26AsNO3
and a molecular weight of 451.40 g/mol.
Molecular Properties
| Compound Name | CID 87728429 |
| PubChem CID | 87728429 |
| Molecular Formula | C24H26AsNO3 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(C(C)([As])C(=O)O)c(-c2ccc(C(=O)CCN)c(CC=C)c2)c1 |
| InChI | InChI=1S/C24H26AsNO3/c1-4-6-16-8-11-21(24(3,25)23(28)29)20(14-16)18-9-10-19(22(27)12-13-26)17(15-18)7-5-2/h4-5,8-11,14-15H,1-2,6-7,12-13,26H2,3H3,(H,28,29) |
| InChIKey | UWFPEWVKWFGIRT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 87728429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87728429?
The IUPAC name of CID 87728429 (CID 87728429) is not available.
What is the SMILES notation for CID 87728429?
The canonical SMILES for CID 87728429 is C=CCc1ccc(C(C)([As])C(=O)O)c(-c2ccc(C(=O)CCN)c(CC=C)c2)c1.
What is the InChIKey of CID 87728429?
The InChIKey is UWFPEWVKWFGIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26AsNO3/c1-4-6-16-8-11-21(24(3,25)23(28)29)20(14-16)18-9-10-19(22(27)12-13-26)17(15-18)7-5-2/h4-5,8-11,14-15H,1-2,6-7,12-13,26H2,3H3,(H,28,29).
What are the key properties of CID 87728429?
CID 87728429 has a molecular weight of 451.40 g/mol, XLogP of 3.81, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87728429 is sourced from PubChem (CID 87728429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).