C21H17F3N4O4 — CID 87729719
(2,2,2-trifluoroacetyl) 4-[[4-[(2-hydroxy-2-phenylethyl)amino]pyrimidin-2-yl]amino]benzoate (PubChem CID 87729719) has the molecular formula C21H17F3N4O4 and a molecular weight of 446.39 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[[4-[(2-hydroxy-2-phenylethyl)amino]pyrimidin-2-yl]amino]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[[4-[(2-hydroxy-2-phenylethyl)amino]pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 87729719 |
| Molecular Formula | C21H17F3N4O4 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[[4-[(2-hydroxy-2-phenylethyl)amino]pyrimidin-2-yl]amino]benzoate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1ccc(Nc2nccc(NCC(O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H17F3N4O4/c22-21(23,24)19(31)32-18(30)14-6-8-15(9-7-14)27-20-25-11-10-17(28-20)26-12-16(29)13-4-2-1-3-5-13/h1-11,16,29H,12H2,(H2,25,26,27,28) |
| InChIKey | KGTBIVJITUMKPP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|