C13H23N2O5+ — CID 8772981
ethyl 1-[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxylate (PubChem CID 8772981) has the molecular formula C13H23N2O5+ and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 1-[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8772981 |
| Molecular Formula | C13H23N2O5+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 1-[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+]([C@H](C)C(=O)NC(=O)OC)CC1 |
| InChI | InChI=1S/C13H22N2O5/c1-4-20-12(17)10-5-7-15(8-6-10)9(2)11(16)14-13(18)19-3/h9-10H,4-8H2,1-3H3,(H,14,16,18)/p+1/t9-/m1/s1 |
| InChIKey | JMXDPLCEJPIGEU-SECBINFHSA-O |
| XLogP | -0.88 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |