C13H25N2O3+ — CID 8754628
methyl 1-[(2R)-1-oxo-1-(propan-2-ylamino)propan-2-yl]piperidin-1-ium-4-carboxylate (PubChem CID 8754628) has the molecular formula C13H25N2O3+ and a molecular weight of 257.35 g/mol. Its IUPAC name is methyl 1-[(2R)-1-oxo-1-(propan-2-ylamino)propan-2-yl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[(2R)-1-oxo-1-(propan-2-ylamino)propan-2-yl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8754628 |
| Molecular Formula | C13H25N2O3+ |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | methyl 1-[(2R)-1-oxo-1-(propan-2-ylamino)propan-2-yl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+]([C@H](C)C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-9(2)14-12(16)10(3)15-7-5-11(6-8-15)13(17)18-4/h9-11H,5-8H2,1-4H3,(H,14,16)/p+1/t10-/m1/s1 |
| InChIKey | ZJHDYNWTLBSVIG-SNVBAGLBSA-O |
| XLogP | -0.63 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |