C28H40N4O5S — CID 87730355
N-[4-[4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]hexanamide (PubChem CID 87730355) has the molecular formula C28H40N4O5S and a molecular weight of 544.72 g/mol. Its IUPAC name is N-[4-[4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]hexanamide.
| Compound Name | N-[4-[4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 87730355 |
| Molecular Formula | C28H40N4O5S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | N-[4-[4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc2c(s1)CCCC2C(=O)N1CCN(Cc2c(OC)cc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C28H40N4O5S/c1-5-6-7-11-25(33)29-28-30-26-20(9-8-10-24(26)38-28)27(34)32-14-12-31(13-15-32)18-21-22(36-3)16-19(35-2)17-23(21)37-4/h16-17,20H,5-15,18H2,1-4H3,(H,29,30,33) |
| InChIKey | TVAOANMBFHYVBA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|