C19H24N2O2S — CID 87733611
ethyl 2-(4-amino-3-methylanilino)-4-phenyl-2-sulfanylbutanoate (PubChem CID 87733611) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is ethyl 2-(4-amino-3-methylanilino)-4-phenyl-2-sulfanylbutanoate.
| Compound Name | ethyl 2-(4-amino-3-methylanilino)-4-phenyl-2-sulfanylbutanoate |
|---|---|
| PubChem CID | 87733611 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethyl 2-(4-amino-3-methylanilino)-4-phenyl-2-sulfanylbutanoate |
| SMILES | CCOC(=O)C(S)(CCc1ccccc1)Nc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-3-23-18(22)19(24,12-11-15-7-5-4-6-8-15)21-16-9-10-17(20)14(2)13-16/h4-10,13,21,24H,3,11-12,20H2,1-2H3 |
| InChIKey | XIUYDNQVYKKQHR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|