C13H10F2NO2+ — CID 8773426
1-(3,4-difluorophenyl)-2-(3-hydroxypyridin-1-ium-1-yl)ethanone (PubChem CID 8773426) has the molecular formula C13H10F2NO2+ and a molecular weight of 250.22 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(3-hydroxypyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(3-hydroxypyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8773426 |
| Molecular Formula | C13H10F2NO2+ |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(3-hydroxypyridin-1-ium-1-yl)ethanone |
| SMILES | O=C(C[n+]1cccc(O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9F2NO2/c14-11-4-3-9(6-12(11)15)13(18)8-16-5-1-2-10(17)7-16/h1-7H,8H2/p+1 |
| InChIKey | GTLDCRIPCIEKIS-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|