C7H12MoO15 — CID 87735288
2-carboxyoxypropane-1,2,3-tricarboxylic acid;dihydroxy(dioxo)molybdenum;hydrogen peroxide (PubChem CID 87735288) has the molecular formula C7H12MoO15 and a molecular weight of 432.10 g/mol. Its IUPAC name is 2-carboxyoxypropane-1,2,3-tricarboxylic acid;dihydroxy(dioxo)molybdenum;hydrogen peroxide.
| Compound Name | 2-carboxyoxypropane-1,2,3-tricarboxylic acid;dihydroxy(dioxo)molybdenum;hydrogen peroxide |
|---|---|
| PubChem CID | 87735288 |
| Molecular Formula | C7H12MoO15 |
| Molecular Weight | 432.10 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 2-carboxyoxypropane-1,2,3-tricarboxylic acid;dihydroxy(dioxo)molybdenum;hydrogen peroxide |
| SMILES | O=C(O)CC(CC(=O)O)(OC(=O)O)C(=O)O.O=[Mo](=O)(O)O.OO |
| InChI | InChI=1S/C7H8O9.Mo.H2O2.2H2O.2O/c8-3(9)1-7(5(12)13,2-4(10)11)16-6(14)15;;1-2;;;;/h1-2H2,(H,8,9)(H,10,11)(H,12,13)(H,14,15);;1-2H;2*1H2;;/q;+2;;;;;/p-2 |
| InChIKey | SKYMCZHYQVOXOE-UHFFFAOYSA-L |
| XLogP | -1.88 |
| TPSA | 273.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.10 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|