C16H38N4Ta — CID 87735870
2-N,2-N-bis(diethylamino)-1-N,1-N-diethyl-2-methylpropane-1,2-diamine;tantalum (PubChem CID 87735870) has the molecular formula C16H38N4Ta and a molecular weight of 467.46 g/mol. Its IUPAC name is 2-N,2-N-bis(diethylamino)-1-N,1-N-diethyl-2-methylpropane-1,2-diamine;tantalum.
| Compound Name | 2-N,2-N-bis(diethylamino)-1-N,1-N-diethyl-2-methylpropane-1,2-diamine;tantalum |
|---|---|
| PubChem CID | 87735870 |
| Molecular Formula | C16H38N4Ta |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-N,2-N-bis(diethylamino)-1-N,1-N-diethyl-2-methylpropane-1,2-diamine;tantalum |
| SMILES | CCN(CC)CC(C)(C)N(N(CC)CC)N(CC)CC.[Ta] |
| InChI | InChI=1S/C16H38N4.Ta/c1-9-17(10-2)15-16(7,8)20(18(11-3)12-4)19(13-5)14-6;/h9-15H2,1-8H3; |
| InChIKey | YRZUTEDJDZGLRL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|