C31H17N3O6S — CID 87735970
5-methyl-2-(14,19,21-trioxo-3,13,20-triazaheptacyclo[16.6.2.14,8.02,13.015,25.022,26.012,27]heptacosa-1(25),2,4,6,8(27),9,11,15,17,22(26),23-undecaen-20-yl)benzenesulfonic acid (PubChem CID 87735970) has the molecular formula C31H17N3O6S and a molecular weight of 559.56 g/mol. Its IUPAC name is 5-methyl-2-(14,19,21-trioxo-3,13,20-triazaheptacyclo[16.6.2.14,8.02,13.015,25.022,26.012,27]heptacosa-1(25),2,4,6,8(27),9,11,15,17,22(26),23-undecaen-20-yl)benzenesulfonic acid.
| Compound Name | 5-methyl-2-(14,19,21-trioxo-3,13,20-triazaheptacyclo[16.6.2.14,8.02,13.015,25.022,26.012,27]heptacosa-1(25),2,4,6,8(27),9,11,15,17,22(26),23-undecaen-20-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87735970 |
| Molecular Formula | C31H17N3O6S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 5-methyl-2-(14,19,21-trioxo-3,13,20-triazaheptacyclo[16.6.2.14,8.02,13.015,25.022,26.012,27]heptacosa-1(25),2,4,6,8(27),9,11,15,17,22(26),23-undecaen-20-yl)benzenesulfonic acid |
| SMILES | Cc1ccc(N2C(=O)c3ccc4c(=O)n5c6cccc7cccc(nc5c5ccc(c3c45)C2=O)c76)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C31H17N3O6S/c1-15-8-13-22(24(14-15)41(38,39)40)34-30(36)19-10-9-17-26-18(11-12-20(27(19)26)31(34)37)29(35)33-23-7-3-5-16-4-2-6-21(25(16)23)32-28(17)33/h2-14H,1H3,(H,38,39,40) |
| InChIKey | XDCWUYQJKKKWMT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|