C20H22FN5O5 — CID 87738535
6-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-3-(1-methoxyethyl)-5-nitro-1-propylpyrimidine-2,4-dione (PubChem CID 87738535) has the molecular formula C20H22FN5O5 and a molecular weight of 431.42 g/mol. Its IUPAC name is 6-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-3-(1-methoxyethyl)-5-nitro-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-3-(1-methoxyethyl)-5-nitro-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87738535 |
| Molecular Formula | C20H22FN5O5 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 6-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-3-(1-methoxyethyl)-5-nitro-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(-c2cnn(Cc3ccccc3F)c2)c([N+](=O)[O-])c(=O)n(C(C)OC)c1=O |
| InChI | InChI=1S/C20H22FN5O5/c1-4-9-24-17(18(26(29)30)19(27)25(20(24)28)13(2)31-3)15-10-22-23(12-15)11-14-7-5-6-8-16(14)21/h5-8,10,12-13H,4,9,11H2,1-3H3 |
| InChIKey | KXXUEKIYJAVAMZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|