C20H23N5O5 — CID 87739532
3-butyl-1-(1-methoxyethyl)-5-nitro-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione (PubChem CID 87739532) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-butyl-1-(1-methoxyethyl)-5-nitro-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione.
| Compound Name | 3-butyl-1-(1-methoxyethyl)-5-nitro-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87739532 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-butyl-1-(1-methoxyethyl)-5-nitro-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)c([N+](=O)[O-])c(-c2cnn(-c3ccccc3)c2)n(C(C)OC)c1=O |
| InChI | InChI=1S/C20H23N5O5/c1-4-5-11-22-19(26)18(25(28)29)17(24(20(22)27)14(2)30-3)15-12-21-23(13-15)16-9-7-6-8-10-16/h6-10,12-14H,4-5,11H2,1-3H3 |
| InChIKey | JBMLQKGBQAPARE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|