C22H24F3N5O5 — CID 87742879
3-butyl-6-[1-methoxy-2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 87742879) has the molecular formula C22H24F3N5O5 and a molecular weight of 495.46 g/mol. Its IUPAC name is 3-butyl-6-[1-methoxy-2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 3-butyl-6-[1-methoxy-2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87742879 |
| Molecular Formula | C22H24F3N5O5 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 3-butyl-6-[1-methoxy-2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)[nH]c(C(Cc2cnn(Cc3ccccc3C(F)(F)F)c2)OC)c([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C22H24F3N5O5/c1-3-4-9-29-20(31)19(30(33)34)18(27-21(29)32)17(35-2)10-14-11-26-28(12-14)13-15-7-5-6-8-16(15)22(23,24)25/h5-8,11-12,17H,3-4,9-10,13H2,1-2H3,(H,27,32) |
| InChIKey | NJAXUVLZUBPEQM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|