C22H25N5O4 — CID 90808576
6-[2-(1-benzylpyrazol-4-yl)ethenyl]-5-nitro-1,3-dipropylpyrimidine-2,4-dione (PubChem CID 90808576) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 6-[2-(1-benzylpyrazol-4-yl)ethenyl]-5-nitro-1,3-dipropylpyrimidine-2,4-dione.
| Compound Name | 6-[2-(1-benzylpyrazol-4-yl)ethenyl]-5-nitro-1,3-dipropylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90808576 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 6-[2-(1-benzylpyrazol-4-yl)ethenyl]-5-nitro-1,3-dipropylpyrimidine-2,4-dione |
| SMILES | CCCn1c(C=Cc2cnn(Cc3ccccc3)c2)c([N+](=O)[O-])c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C22H25N5O4/c1-3-12-25-19(20(27(30)31)21(28)26(13-4-2)22(25)29)11-10-18-14-23-24(16-18)15-17-8-6-5-7-9-17/h5-11,14,16H,3-4,12-13,15H2,1-2H3 |
| InChIKey | JGXZJIYPZVRXNP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|