C33H22F9N5O4 — CID 90970202
5-nitro-1,3-bis[[4-(trifluoromethyl)phenyl]methyl]-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione (PubChem CID 90970202) has the molecular formula C33H22F9N5O4 and a molecular weight of 723.55 g/mol. Its IUPAC name is 5-nitro-1,3-bis[[4-(trifluoromethyl)phenyl]methyl]-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione.
| Compound Name | 5-nitro-1,3-bis[[4-(trifluoromethyl)phenyl]methyl]-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90970202 |
| Molecular Formula | C33H22F9N5O4 |
| Molecular Weight | 723.55 g/mol |
| Exact Mass | 723.15 |
| IUPAC Name | 5-nitro-1,3-bis[[4-(trifluoromethyl)phenyl]methyl]-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione |
| SMILES | O=c1c([N+](=O)[O-])c(C=Cc2cnn(Cc3ccccc3C(F)(F)F)c2)n(Cc2ccc(C(F)(F)F)cc2)c(=O)n1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H22F9N5O4/c34-31(35,36)24-10-5-20(6-11-24)17-45-27(14-9-22-15-43-44(16-22)19-23-3-1-2-4-26(23)33(40,41)42)28(47(50)51)29(48)46(30(45)49)18-21-7-12-25(13-8-21)32(37,38)39/h1-16H,17-19H2 |
| InChIKey | QAFMDJBROOEYLT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|