C23H19F3N4O4 — CID 10344734
1,3-dimethyl-5-nitro-6-[(E)-2-[4-[[4-(trifluoromethyl)phenyl]methyliminomethyl]phenyl]ethenyl]pyrimidine-2,4-dione (PubChem CID 10344734) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitro-6-[(E)-2-[4-[[4-(trifluoromethyl)phenyl]methyliminomethyl]phenyl]ethenyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-nitro-6-[(E)-2-[4-[[4-(trifluoromethyl)phenyl]methyliminomethyl]phenyl]ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10344734 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1,3-dimethyl-5-nitro-6-[(E)-2-[4-[[4-(trifluoromethyl)phenyl]methyliminomethyl]phenyl]ethenyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(/C=C/c2ccc(/C=N/Cc3ccc(C(F)(F)F)cc3)cc2)c([N+](=O)[O-])c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H19F3N4O4/c1-28-19(20(30(33)34)21(31)29(2)22(28)32)12-9-15-3-5-16(6-4-15)13-27-14-17-7-10-18(11-8-17)23(24,25)26/h3-13H,14H2,1-2H3/b12-9+,27-13+ |
| InChIKey | RRXRYMXVMCOPNA-FOUIEBFVSA-N |
| XLogP | 3.80 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|