C22H26N4O8 — CID 142197131
2-[4-[2-[1-methyl-3-(3-morpholin-4-ylpropyl)-5-nitro-2,6-dioxopyrimidin-4-yl]ethenyl]phenoxy]acetic acid (PubChem CID 142197131) has the molecular formula C22H26N4O8 and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-[4-[2-[1-methyl-3-(3-morpholin-4-ylpropyl)-5-nitro-2,6-dioxopyrimidin-4-yl]ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[1-methyl-3-(3-morpholin-4-ylpropyl)-5-nitro-2,6-dioxopyrimidin-4-yl]ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142197131 |
| Molecular Formula | C22H26N4O8 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[4-[2-[1-methyl-3-(3-morpholin-4-ylpropyl)-5-nitro-2,6-dioxopyrimidin-4-yl]ethenyl]phenoxy]acetic acid |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(C=Cc2ccc(OCC(=O)O)cc2)n(CCCN2CCOCC2)c1=O |
| InChI | InChI=1S/C22H26N4O8/c1-23-21(29)20(26(31)32)18(8-5-16-3-6-17(7-4-16)34-15-19(27)28)25(22(23)30)10-2-9-24-11-13-33-14-12-24/h3-8H,2,9-15H2,1H3,(H,27,28) |
| InChIKey | FNENSVYPXYJSTA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|