C18H19N3O7 — CID 11523940
ethyl 2-[4-[(E)-2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]phenoxy]acetate (PubChem CID 11523940) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 11523940 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | ethyl 2-[4-[(E)-2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C/c2c([N+](=O)[O-])c(=O)n(C)c(=O)n2C)cc1 |
| InChI | InChI=1S/C18H19N3O7/c1-4-27-15(22)11-28-13-8-5-12(6-9-13)7-10-14-16(21(25)26)17(23)20(3)18(24)19(14)2/h5-10H,4,11H2,1-3H3/b10-7+ |
| InChIKey | PXGSCRCHQBUYTQ-JXMROGBWSA-N |
| XLogP | 1.10 |
| TPSA | 122.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|