C30H24FN5O5 — CID 87725576
3-[fluoro(phenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-nitro-6-[(E)-2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione (PubChem CID 87725576) has the molecular formula C30H24FN5O5 and a molecular weight of 553.55 g/mol. Its IUPAC name is 3-[fluoro(phenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-nitro-6-[(E)-2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione.
| Compound Name | 3-[fluoro(phenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-nitro-6-[(E)-2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87725576 |
| Molecular Formula | C30H24FN5O5 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 3-[fluoro(phenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-nitro-6-[(E)-2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(/C=C/c3cnn(-c4ccccc4)c3)c([N+](=O)[O-])c(=O)n(C(F)c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C30H24FN5O5/c1-41-25-15-12-21(13-16-25)19-33-26(17-14-22-18-32-34(20-22)24-10-6-3-7-11-24)27(36(39)40)29(37)35(30(33)38)28(31)23-8-4-2-5-9-23/h2-18,20,28H,19H2,1H3/b17-14+ |
| InChIKey | QRMPWGLVGVKDAY-SAPNQHFASA-N |
| XLogP | 4.85 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|