C29H25N5O4 — CID 87738645
5-nitro-1,3-bis(1-phenylethyl)-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione (PubChem CID 87738645) has the molecular formula C29H25N5O4 and a molecular weight of 507.55 g/mol. Its IUPAC name is 5-nitro-1,3-bis(1-phenylethyl)-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione.
| Compound Name | 5-nitro-1,3-bis(1-phenylethyl)-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87738645 |
| Molecular Formula | C29H25N5O4 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 5-nitro-1,3-bis(1-phenylethyl)-6-(1-phenylpyrazol-4-yl)pyrimidine-2,4-dione |
| SMILES | CC(c1ccccc1)n1c(-c2cnn(-c3ccccc3)c2)c([N+](=O)[O-])c(=O)n(C(C)c2ccccc2)c1=O |
| InChI | InChI=1S/C29H25N5O4/c1-20(22-12-6-3-7-13-22)32-26(24-18-30-31(19-24)25-16-10-5-11-17-25)27(34(37)38)28(35)33(29(32)36)21(2)23-14-8-4-9-15-23/h3-21H,1-2H3 |
| InChIKey | ARXZSMVZRULDJZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|