C23H23N5O4 — CID 91357439
1,3-di(cyclobutyl)-5-nitro-6-[2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione (PubChem CID 91357439) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 1,3-di(cyclobutyl)-5-nitro-6-[2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-di(cyclobutyl)-5-nitro-6-[2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91357439 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1,3-di(cyclobutyl)-5-nitro-6-[2-(1-phenylpyrazol-4-yl)ethenyl]pyrimidine-2,4-dione |
| SMILES | O=c1c([N+](=O)[O-])c(C=Cc2cnn(-c3ccccc3)c2)n(C2CCC2)c(=O)n1C1CCC1 |
| InChI | InChI=1S/C23H23N5O4/c29-22-21(28(31)32)20(13-12-16-14-24-25(15-16)17-6-2-1-3-7-17)26(18-8-4-9-18)23(30)27(22)19-10-5-11-19/h1-3,6-7,12-15,18-19H,4-5,8-11H2 |
| InChIKey | AMGRBMWHULIBIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|