C28H26FN5O4 — CID 173145712
3-cyclobutyl-6-[2-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]ethenyl]-5-nitro-1-(1-phenylethyl)pyrimidine-2,4-dione (PubChem CID 173145712) has the molecular formula C28H26FN5O4 and a molecular weight of 515.55 g/mol. Its IUPAC name is 3-cyclobutyl-6-[2-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]ethenyl]-5-nitro-1-(1-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 3-cyclobutyl-6-[2-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]ethenyl]-5-nitro-1-(1-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173145712 |
| Molecular Formula | C28H26FN5O4 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 3-cyclobutyl-6-[2-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]ethenyl]-5-nitro-1-(1-phenylethyl)pyrimidine-2,4-dione |
| SMILES | CC(c1ccccc1)n1c(C=Cc2cnn(Cc3ccccc3F)c2)c([N+](=O)[O-])c(=O)n(C2CCC2)c1=O |
| InChI | InChI=1S/C28H26FN5O4/c1-19(21-8-3-2-4-9-21)32-25(26(34(37)38)27(35)33(28(32)36)23-11-7-12-23)15-14-20-16-30-31(17-20)18-22-10-5-6-13-24(22)29/h2-6,8-10,13-17,19,23H,7,11-12,18H2,1H3 |
| InChIKey | RJYGVFYCRPKQBC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|