C29H28F3N5O4 — CID 91537824
1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione (PubChem CID 91537824) has the molecular formula C29H28F3N5O4 and a molecular weight of 567.57 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91537824 |
| Molecular Formula | C29H28F3N5O4 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)-6-[2-[1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]ethenyl]pyrimidine-2,4-dione |
| SMILES | CC(C)Cn1c(C=Cc2cnn(Cc3ccccc3C(F)(F)F)c2)c([N+](=O)[O-])c(=O)n(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C29H28F3N5O4/c1-20(2)17-36-25(26(37(40)41)27(38)35(28(36)39)15-14-21-8-4-3-5-9-21)13-12-22-16-33-34(18-22)19-23-10-6-7-11-24(23)29(30,31)32/h3-13,16,18,20H,14-15,17,19H2,1-2H3 |
| InChIKey | YNTLSQQTXHVSLC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|