C22H19N7O4 — CID 87725065
6-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-5-nitro-1,3-bis(pyridin-4-ylmethyl)pyrimidine-2,4-dione (PubChem CID 87725065) has the molecular formula C22H19N7O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 6-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-5-nitro-1,3-bis(pyridin-4-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-5-nitro-1,3-bis(pyridin-4-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87725065 |
| Molecular Formula | C22H19N7O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 6-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-5-nitro-1,3-bis(pyridin-4-ylmethyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(/C=C/c2c([N+](=O)[O-])c(=O)n(Cc3ccncc3)c(=O)n2Cc2ccncc2)cn1 |
| InChI | InChI=1S/C22H19N7O4/c1-26-13-18(12-25-26)2-3-19-20(29(32)33)21(30)28(15-17-6-10-24-11-7-17)22(31)27(19)14-16-4-8-23-9-5-16/h2-13H,14-15H2,1H3/b3-2+ |
| InChIKey | INHBAQPAUYYYCU-NSCUHMNNSA-N |
| XLogP | 1.71 |
| TPSA | 130.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|