C15H16N4O4 — CID 87725586
1-(cyclopropylmethyl)-6-methyl-5-nitro-3-(pyridin-4-ylmethyl)pyrimidine-2,4-dione (PubChem CID 87725586) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-6-methyl-5-nitro-3-(pyridin-4-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-6-methyl-5-nitro-3-(pyridin-4-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87725586 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-6-methyl-5-nitro-3-(pyridin-4-ylmethyl)pyrimidine-2,4-dione |
| SMILES | Cc1c([N+](=O)[O-])c(=O)n(Cc2ccncc2)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C15H16N4O4/c1-10-13(19(22)23)14(20)18(9-12-4-6-16-7-5-12)15(21)17(10)8-11-2-3-11/h4-7,11H,2-3,8-9H2,1H3 |
| InChIKey | ZTPIDRHXWFMLRM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|