C17H22N2 — CID 87740940
(4-benzyl-5-azoniatricyclo[4.2.2.11,4]undecan-5-ylidene)azanide (PubChem CID 87740940) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (4-benzyl-5-azoniatricyclo[4.2.2.11,4]undecan-5-ylidene)azanide.
| Compound Name | (4-benzyl-5-azoniatricyclo[4.2.2.11,4]undecan-5-ylidene)azanide |
|---|---|
| PubChem CID | 87740940 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (4-benzyl-5-azoniatricyclo[4.2.2.11,4]undecan-5-ylidene)azanide |
| SMILES | [N-]=[N+]1C2CCC3(CC2)CCC1(Cc1ccccc1)C3 |
| InChI | InChI=1S/C17H22N2/c18-19-15-6-8-16(9-7-15)10-11-17(19,13-16)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2 |
| InChIKey | OBGVMZRYMNDRML-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|