C18H19F6N3O2 — CID 87741167
N-[2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 87741167) has the molecular formula C18H19F6N3O2 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87741167 |
| Molecular Formula | C18H19F6N3O2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN(C(=O)C(F)(F)F)c1cccc(C(F)(F)F)c1)NC1CC2CNCC2C1 |
| InChI | InChI=1S/C18H19F6N3O2/c19-17(20,21)12-2-1-3-14(6-12)27(16(29)18(22,23)24)9-15(28)26-13-4-10-7-25-8-11(10)5-13/h1-3,6,10-11,13,25H,4-5,7-9H2,(H,26,28) |
| InChIKey | WASBXYOWLIQBCN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |