C17H24FNO5 — CID 87743291
tert-butyl [3-[fluoro-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl] carbonate (PubChem CID 87743291) has the molecular formula C17H24FNO5 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl [3-[fluoro-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl] carbonate.
| Compound Name | tert-butyl [3-[fluoro-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 87743291 |
| Molecular Formula | C17H24FNO5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl [3-[fluoro-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(C(F)N(C=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24FNO5/c1-16(2,3)23-15(21)22-13-9-7-8-12(10-13)14(18)19(11-20)24-17(4,5)6/h7-11,14H,1-6H3 |
| InChIKey | YZGAKIVBHRCMJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|