C21H34N2O4 — CID 87746605
2,3,4-tris(2-methylbutan-2-yl)-1,5-dinitrobenzene (PubChem CID 87746605) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2,3,4-tris(2-methylbutan-2-yl)-1,5-dinitrobenzene.
| Compound Name | 2,3,4-tris(2-methylbutan-2-yl)-1,5-dinitrobenzene |
|---|---|
| PubChem CID | 87746605 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2,3,4-tris(2-methylbutan-2-yl)-1,5-dinitrobenzene |
| SMILES | CCC(C)(C)c1c([N+](=O)[O-])cc([N+](=O)[O-])c(C(C)(C)CC)c1C(C)(C)CC |
| InChI | InChI=1S/C21H34N2O4/c1-10-19(4,5)16-14(22(24)25)13-15(23(26)27)17(20(6,7)11-2)18(16)21(8,9)12-3/h13H,10-12H2,1-9H3 |
| InChIKey | DJIFZIXDQPDJNS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|