C24H32N5O2+ — CID 87747471
[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]indolizin-4-ium-1-yl]urea (PubChem CID 87747471) has the molecular formula C24H32N5O2+ and a molecular weight of 422.55 g/mol. Its IUPAC name is [4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]indolizin-4-ium-1-yl]urea.
| Compound Name | [4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]indolizin-4-ium-1-yl]urea |
|---|---|
| PubChem CID | 87747471 |
| Molecular Formula | C24H32N5O2+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]indolizin-4-ium-1-yl]urea |
| SMILES | COc1ccccc1N1CCN(CCCC[N+]23C=CC=CC2=C(NC(N)=O)C=C3)CC1 |
| InChI | InChI=1S/C24H31N5O2/c1-31-23-10-3-2-8-21(23)28-15-13-27(14-16-28)12-5-7-18-29-17-6-4-9-22(29)20(11-19-29)26-24(25)30/h2-4,6,8-11,17,19H,5,7,12-16,18H2,1H3,(H2-,25,26,30)/p+1 |
| InChIKey | GJSJDSRIGKWPMY-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|